C18H26IN5O2 — CID 139414082
tert-butyl N-[1-(5-amino-7-iodo-1-methylindazol-4-yl)piperidin-3-yl]carbamate (PubChem CID 139414082) has the molecular formula C18H26IN5O2 and a molecular weight of 471.34 g/mol. Its IUPAC name is tert-butyl N-[1-(5-amino-7-iodo-1-methylindazol-4-yl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(5-amino-7-iodo-1-methylindazol-4-yl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 139414082 |
| Molecular Formula | C18H26IN5O2 |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | tert-butyl N-[1-(5-amino-7-iodo-1-methylindazol-4-yl)piperidin-3-yl]carbamate |
| SMILES | Cn1ncc2c(N3CCCC(NC(=O)OC(C)(C)C)C3)c(N)cc(I)c21 |
| InChI | InChI=1S/C18H26IN5O2/c1-18(2,3)26-17(25)22-11-6-5-7-24(10-11)16-12-9-21-23(4)15(12)13(19)8-14(16)20/h8-9,11H,5-7,10,20H2,1-4H3,(H,22,25) |
| InChIKey | ANJGXOROFIBQNL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|