C18H24IN5O4 — CID 139414046
tert-butyl N-[(3R)-1-(7-iodo-1-methyl-5-nitroindazol-4-yl)piperidin-3-yl]carbamate (PubChem CID 139414046) has the molecular formula C18H24IN5O4 and a molecular weight of 501.33 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-(7-iodo-1-methyl-5-nitroindazol-4-yl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-(7-iodo-1-methyl-5-nitroindazol-4-yl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 139414046 |
| Molecular Formula | C18H24IN5O4 |
| Molecular Weight | 501.33 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | tert-butyl N-[(3R)-1-(7-iodo-1-methyl-5-nitroindazol-4-yl)piperidin-3-yl]carbamate |
| SMILES | Cn1ncc2c(N3CCC[C@@H](NC(=O)OC(C)(C)C)C3)c([N+](=O)[O-])cc(I)c21 |
| InChI | InChI=1S/C18H24IN5O4/c1-18(2,3)28-17(25)21-11-6-5-7-23(10-11)16-12-9-20-22(4)15(12)13(19)8-14(16)24(26)27/h8-9,11H,5-7,10H2,1-4H3,(H,21,25)/t11-/m1/s1 |
| InChIKey | HYUFZYJYPFGLPB-LLVKDONJSA-N |
| XLogP | 3.58 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|