C19H25BN4O6 — CID 174068181
[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-3-nitroquinolin-6-yl]boronic acid (PubChem CID 174068181) has the molecular formula C19H25BN4O6 and a molecular weight of 416.24 g/mol. Its IUPAC name is [4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-3-nitroquinolin-6-yl]boronic acid.
| Compound Name | [4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-3-nitroquinolin-6-yl]boronic acid |
|---|---|
| PubChem CID | 174068181 |
| Molecular Formula | C19H25BN4O6 |
| Molecular Weight | 416.24 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | [4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-3-nitroquinolin-6-yl]boronic acid |
| SMILES | CC(C)(C)OC(=O)NC1CCCN(c2c([N+](=O)[O-])cnc3ccc(B(O)O)cc23)C1 |
| InChI | InChI=1S/C19H25BN4O6/c1-19(2,3)30-18(25)22-13-5-4-8-23(11-13)17-14-9-12(20(26)27)6-7-15(14)21-10-16(17)24(28)29/h6-7,9-10,13,26-27H,4-5,8,11H2,1-3H3,(H,22,25) |
| InChIKey | ZDMXBKQYRBAOLV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 138.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|