C21H27N5O4 — CID 158222237
tert-butyl N-[1-[2-[(2-nitrophenyl)methyl]pyrimidin-4-yl]piperidin-3-yl]carbamate (PubChem CID 158222237) has the molecular formula C21H27N5O4 and a molecular weight of 413.48 g/mol. Its IUPAC name is tert-butyl N-[1-[2-[(2-nitrophenyl)methyl]pyrimidin-4-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-[(2-nitrophenyl)methyl]pyrimidin-4-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 158222237 |
| Molecular Formula | C21H27N5O4 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | tert-butyl N-[1-[2-[(2-nitrophenyl)methyl]pyrimidin-4-yl]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCN(c2ccnc(Cc3ccccc3[N+](=O)[O-])n2)C1 |
| InChI | InChI=1S/C21H27N5O4/c1-21(2,3)30-20(27)23-16-8-6-12-25(14-16)19-10-11-22-18(24-19)13-15-7-4-5-9-17(15)26(28)29/h4-5,7,9-11,16H,6,8,12-14H2,1-3H3,(H,23,27) |
| InChIKey | SGDXSDAOHSNAQO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|