C27H31N3O4 — CID 59848811
tert-butyl N-[(3R)-1-[3-(2-naphthalen-1-ylethyl)-4-nitrophenyl]pyrrolidin-3-yl]carbamate (PubChem CID 59848811) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[3-(2-naphthalen-1-ylethyl)-4-nitrophenyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[3-(2-naphthalen-1-ylethyl)-4-nitrophenyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 59848811 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | tert-butyl N-[(3R)-1-[3-(2-naphthalen-1-ylethyl)-4-nitrophenyl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN(c2ccc([N+](=O)[O-])c(CCc3cccc4ccccc34)c2)C1 |
| InChI | InChI=1S/C27H31N3O4/c1-27(2,3)34-26(31)28-22-15-16-29(18-22)23-13-14-25(30(32)33)21(17-23)12-11-20-9-6-8-19-7-4-5-10-24(19)20/h4-10,13-14,17,22H,11-12,15-16,18H2,1-3H3,(H,28,31)/t22-/m1/s1 |
| InChIKey | GFMUASZWERNACK-JOCHJYFZSA-N |
| XLogP | 5.64 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|