C19H27N5O5 — CID 168988671
tert-butyl N-[(3S)-1-[2-(methoxymethyl)-1-methyl-5-nitrobenzimidazol-4-yl]pyrrolidin-3-yl]carbamate (PubChem CID 168988671) has the molecular formula C19H27N5O5 and a molecular weight of 405.46 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[2-(methoxymethyl)-1-methyl-5-nitrobenzimidazol-4-yl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[2-(methoxymethyl)-1-methyl-5-nitrobenzimidazol-4-yl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 168988671 |
| Molecular Formula | C19H27N5O5 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | tert-butyl N-[(3S)-1-[2-(methoxymethyl)-1-methyl-5-nitrobenzimidazol-4-yl]pyrrolidin-3-yl]carbamate |
| SMILES | COCc1nc2c(N3CC[C@H](NC(=O)OC(C)(C)C)C3)c([N+](=O)[O-])ccc2n1C |
| InChI | InChI=1S/C19H27N5O5/c1-19(2,3)29-18(25)20-12-8-9-23(10-12)17-14(24(26)27)7-6-13-16(17)21-15(11-28-5)22(13)4/h6-7,12H,8-11H2,1-5H3,(H,20,25)/t12-/m0/s1 |
| InChIKey | PXCNEBQQUZWMPZ-LBPRGKRZSA-N |
| XLogP | 2.73 |
| TPSA | 111.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|