C17H29N5O2 — CID 67087344
tert-butyl N-[(3R)-1-[2-(2-methylpropylamino)pyrimidin-4-yl]pyrrolidin-3-yl]carbamate (PubChem CID 67087344) has the molecular formula C17H29N5O2 and a molecular weight of 335.45 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[2-(2-methylpropylamino)pyrimidin-4-yl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[2-(2-methylpropylamino)pyrimidin-4-yl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 67087344 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | tert-butyl N-[(3R)-1-[2-(2-methylpropylamino)pyrimidin-4-yl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)CNc1nccc(N2CC[C@@H](NC(=O)OC(C)(C)C)C2)n1 |
| InChI | InChI=1S/C17H29N5O2/c1-12(2)10-19-15-18-8-6-14(21-15)22-9-7-13(11-22)20-16(23)24-17(3,4)5/h6,8,12-13H,7,9-11H2,1-5H3,(H,20,23)(H,18,19,21)/t13-/m1/s1 |
| InChIKey | WRXYWMJUXYYJBM-CYBMUJFWSA-N |
| XLogP | 2.65 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |