C25H40N2O3Si — CID 164566876
tert-butyl N-[2-[2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexyl]ethynyl]-4-pyridinyl]carbamate (PubChem CID 164566876) has the molecular formula C25H40N2O3Si and a molecular weight of 444.69 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexyl]ethynyl]-4-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexyl]ethynyl]-4-pyridinyl]carbamate |
|---|---|
| PubChem CID | 164566876 |
| Molecular Formula | C25H40N2O3Si |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | tert-butyl N-[2-[2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexyl]ethynyl]-4-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccnc(C#CC2CCC(CO[Si](C)(C)C(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C25H40N2O3Si/c1-24(2,3)30-23(28)27-22-15-16-26-21(17-22)14-13-19-9-11-20(12-10-19)18-29-31(7,8)25(4,5)6/h15-17,19-20H,9-12,18H2,1-8H3,(H,26,27,28) |
| InChIKey | DHTGXTUFTCUMRY-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|