C15H31NO3Si — CID 66732037
methyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methylpiperidine-1-carboxylate (PubChem CID 66732037) has the molecular formula C15H31NO3Si and a molecular weight of 301.50 g/mol. Its IUPAC name is methyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methylpiperidine-1-carboxylate.
| Compound Name | methyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 66732037 |
| Molecular Formula | C15H31NO3Si |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.21 |
| IUPAC Name | methyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methylpiperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(CO[Si](C)(C)C(C)(C)C)CC1C |
| InChI | InChI=1S/C15H31NO3Si/c1-12-10-13(8-9-16(12)14(17)18-5)11-19-20(6,7)15(2,3)4/h12-13H,8-11H2,1-7H3 |
| InChIKey | DCPYQILSMQCRRK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|