C22H27NO2 — CID 71650307
(3S,4R)-1-benzyl-4-(2-tert-butylphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 71650307) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-4-(2-tert-butylphenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4R)-1-benzyl-4-(2-tert-butylphenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 71650307 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (3S,4R)-1-benzyl-4-(2-tert-butylphenyl)pyrrolidine-3-carboxylic acid |
| SMILES | CC(C)(C)c1ccccc1[C@@H]1CN(Cc2ccccc2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C22H27NO2/c1-22(2,3)20-12-8-7-11-17(20)18-14-23(15-19(18)21(24)25)13-16-9-5-4-6-10-16/h4-12,18-19H,13-15H2,1-3H3,(H,24,25)/t18-,19+/m0/s1 |
| InChIKey | BVCSMMHEJUJYIF-RBUKOAKNSA-N |
| XLogP | 4.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |