C19H25NO3 — CID 102141683
methyl (2S)-1-benzoyl-1-azaspiro[4.6]undecane-2-carboxylate (PubChem CID 102141683) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is methyl (2S)-1-benzoyl-1-azaspiro[4.6]undecane-2-carboxylate.
| Compound Name | methyl (2S)-1-benzoyl-1-azaspiro[4.6]undecane-2-carboxylate |
|---|---|
| PubChem CID | 102141683 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | methyl (2S)-1-benzoyl-1-azaspiro[4.6]undecane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCC2(CCCCCC2)N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H25NO3/c1-23-18(22)16-11-14-19(12-7-2-3-8-13-19)20(16)17(21)15-9-5-4-6-10-15/h4-6,9-10,16H,2-3,7-8,11-14H2,1H3/t16-/m0/s1 |
| InChIKey | MIVCGMCTECVSFH-INIZCTEOSA-N |
| XLogP | 3.56 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |