C16H17NO6 — CID 95731671
dimethyl (2R,4S)-1-benzoyl-5-oxopiperidine-2,4-dicarboxylate (PubChem CID 95731671) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is dimethyl (2R,4S)-1-benzoyl-5-oxopiperidine-2,4-dicarboxylate.
| Compound Name | dimethyl (2R,4S)-1-benzoyl-5-oxopiperidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 95731671 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | dimethyl (2R,4S)-1-benzoyl-5-oxopiperidine-2,4-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@H](C(=O)OC)N(C(=O)c2ccccc2)CC1=O |
| InChI | InChI=1S/C16H17NO6/c1-22-15(20)11-8-12(16(21)23-2)17(9-13(11)18)14(19)10-6-4-3-5-7-10/h3-7,11-12H,8-9H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | KQXKRUDATDKFEL-NWDGAFQWSA-N |
| XLogP | 0.43 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|