C36H42N2O12 — CID 71669607
diethyl 1-benzoyl-3-oxopiperidine-2,6-dicarboxylate;diethyl 1-benzoyl-5-oxopiperidine-2,4-dicarboxylate (PubChem CID 71669607) has the molecular formula C36H42N2O12 and a molecular weight of 694.73 g/mol. Its IUPAC name is diethyl 1-benzoyl-3-oxopiperidine-2,6-dicarboxylate;diethyl 1-benzoyl-5-oxopiperidine-2,4-dicarboxylate.
| Compound Name | diethyl 1-benzoyl-3-oxopiperidine-2,6-dicarboxylate;diethyl 1-benzoyl-5-oxopiperidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 71669607 |
| Molecular Formula | C36H42N2O12 |
| Molecular Weight | 694.73 g/mol |
| Exact Mass | 694.27 |
| IUPAC Name | diethyl 1-benzoyl-3-oxopiperidine-2,6-dicarboxylate;diethyl 1-benzoyl-5-oxopiperidine-2,4-dicarboxylate |
| SMILES | CCOC(=O)C1CC(C(=O)OCC)N(C(=O)c2ccccc2)CC1=O.CCOC(=O)C1CCC(=O)C(C(=O)OCC)N1C(=O)c1ccccc1 |
| InChI | InChI=1S/2C18H21NO6/c1-3-24-17(22)13-10-14(18(23)25-4-2)19(11-15(13)20)16(21)12-8-6-5-7-9-12;1-3-24-17(22)13-10-11-14(20)15(18(23)25-4-2)19(13)16(21)12-8-6-5-7-9-12/h5-9,13-14H,3-4,10-11H2,1-2H3;5-9,13,15H,3-4,10-11H2,1-2H3 |
| InChIKey | MTXPOHQKJANMDT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 179.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.73 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|