C20H31NO3Si — CID 134918210
1-benzoyl-4-[tert-butyl(dimethyl)silyl]oxyazocan-2-one (PubChem CID 134918210) has the molecular formula C20H31NO3Si and a molecular weight of 361.56 g/mol. Its IUPAC name is 1-benzoyl-4-[tert-butyl(dimethyl)silyl]oxyazocan-2-one.
| Compound Name | 1-benzoyl-4-[tert-butyl(dimethyl)silyl]oxyazocan-2-one |
|---|---|
| PubChem CID | 134918210 |
| Molecular Formula | C20H31NO3Si |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 1-benzoyl-4-[tert-butyl(dimethyl)silyl]oxyazocan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCCN(C(=O)c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C20H31NO3Si/c1-20(2,3)25(4,5)24-17-13-9-10-14-21(18(22)15-17)19(23)16-11-7-6-8-12-16/h6-8,11-12,17H,9-10,13-15H2,1-5H3 |
| InChIKey | VFNVDXVZWKJQEQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|