C20H33NO4Si — CID 11036265
benzyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)piperidine-1-carboxylate (PubChem CID 11036265) has the molecular formula C20H33NO4Si and a molecular weight of 379.57 g/mol. Its IUPAC name is benzyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)piperidine-1-carboxylate.
| Compound Name | benzyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11036265 |
| Molecular Formula | C20H33NO4Si |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | benzyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCCN(C(=O)OCc2ccccc2)[C@H]1CO |
| InChI | InChI=1S/C20H33NO4Si/c1-20(2,3)26(4,5)25-18-12-9-13-21(17(18)14-22)19(23)24-15-16-10-7-6-8-11-16/h6-8,10-11,17-18,22H,9,12-15H2,1-5H3/t17-,18+/m0/s1 |
| InChIKey | KLHPXOGDRHKOSV-ZWKOTPCHSA-N |
| XLogP | 4.17 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|