C26H37NO4Si — CID 101131554
benzyl (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-methoxyphenyl)piperidine-1-carboxylate (PubChem CID 101131554) has the molecular formula C26H37NO4Si and a molecular weight of 455.67 g/mol. Its IUPAC name is benzyl (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-methoxyphenyl)piperidine-1-carboxylate.
| Compound Name | benzyl (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-methoxyphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 101131554 |
| Molecular Formula | C26H37NO4Si |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | benzyl (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(4-methoxyphenyl)piperidine-1-carboxylate |
| SMILES | COc1ccc(C2[C@H](O[Si](C)(C)C(C)(C)C)CCCN2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H37NO4Si/c1-26(2,3)32(5,6)31-23-13-10-18-27(24(23)21-14-16-22(29-4)17-15-21)25(28)30-19-20-11-8-7-9-12-20/h7-9,11-12,14-17,23-24H,10,13,18-19H2,1-6H3/t23-,24?/m1/s1 |
| InChIKey | OPUQIXVMFQQAJP-MIHMCVIASA-N |
| XLogP | 6.56 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|