C26H35NO4 — CID 21436242
benzyl 3-(3-hydroxypentan-3-yl)-2-[(4-methoxyphenyl)methyl]piperidine-1-carboxylate (PubChem CID 21436242) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is benzyl 3-(3-hydroxypentan-3-yl)-2-[(4-methoxyphenyl)methyl]piperidine-1-carboxylate.
| Compound Name | benzyl 3-(3-hydroxypentan-3-yl)-2-[(4-methoxyphenyl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 21436242 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | benzyl 3-(3-hydroxypentan-3-yl)-2-[(4-methoxyphenyl)methyl]piperidine-1-carboxylate |
| SMILES | CCC(O)(CC)C1CCCN(C(=O)OCc2ccccc2)C1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H35NO4/c1-4-26(29,5-2)23-12-9-17-27(25(28)31-19-21-10-7-6-8-11-21)24(23)18-20-13-15-22(30-3)16-14-20/h6-8,10-11,13-16,23-24,29H,4-5,9,12,17-19H2,1-3H3 |
| InChIKey | OGSVNVMILDLFEI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |