C21H25NO3 — CID 102574971
1-[(2R,3S)-2-(4-methoxyphenyl)-3-phenylmethoxypiperidin-1-yl]ethanone (PubChem CID 102574971) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-[(2R,3S)-2-(4-methoxyphenyl)-3-phenylmethoxypiperidin-1-yl]ethanone.
| Compound Name | 1-[(2R,3S)-2-(4-methoxyphenyl)-3-phenylmethoxypiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 102574971 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 1-[(2R,3S)-2-(4-methoxyphenyl)-3-phenylmethoxypiperidin-1-yl]ethanone |
| SMILES | COc1ccc([C@@H]2[C@@H](OCc3ccccc3)CCCN2C(C)=O)cc1 |
| InChI | InChI=1S/C21H25NO3/c1-16(23)22-14-6-9-20(25-15-17-7-4-3-5-8-17)21(22)18-10-12-19(24-2)13-11-18/h3-5,7-8,10-13,20-21H,6,9,14-15H2,1-2H3/t20-,21+/m0/s1 |
| InChIKey | PCDZLEUHEPZTPM-LEWJYISDSA-N |
| XLogP | 3.96 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |