C24H37NO5Si — CID 10551415
benzyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1-methoxy-1-oxopent-4-en-2-yl)pyrrolidine-1-carboxylate (PubChem CID 10551415) has the molecular formula C24H37NO5Si and a molecular weight of 447.65 g/mol. Its IUPAC name is benzyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1-methoxy-1-oxopent-4-en-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1-methoxy-1-oxopent-4-en-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10551415 |
| Molecular Formula | C24H37NO5Si |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | benzyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(1-methoxy-1-oxopent-4-en-2-yl)pyrrolidine-1-carboxylate |
| SMILES | C=CCC(C(=O)OC)[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H37NO5Si/c1-8-12-19(22(26)28-5)21-20(30-31(6,7)24(2,3)4)15-16-25(21)23(27)29-17-18-13-10-9-11-14-18/h8-11,13-14,19-21H,1,12,15-17H2,2-7H3/t19?,20-,21+/m0/s1 |
| InChIKey | DUWBOVWUGUZKBS-GJGLBJJNSA-N |
| XLogP | 5.15 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|