C25H37NO3Si — CID 53375564
benzyl (3S,4aS,5R,8aS)-5-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-3,4,4a,5,6,8a-hexahydro-2H-quinoline-1-carboxylate (PubChem CID 53375564) has the molecular formula C25H37NO3Si and a molecular weight of 427.66 g/mol. Its IUPAC name is benzyl (3S,4aS,5R,8aS)-5-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-3,4,4a,5,6,8a-hexahydro-2H-quinoline-1-carboxylate.
| Compound Name | benzyl (3S,4aS,5R,8aS)-5-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-3,4,4a,5,6,8a-hexahydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 53375564 |
| Molecular Formula | C25H37NO3Si |
| Molecular Weight | 427.66 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | benzyl (3S,4aS,5R,8aS)-5-[tert-butyl(dimethyl)silyl]oxy-3-ethenyl-3,4,4a,5,6,8a-hexahydro-2H-quinoline-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@@H]2[C@H](O[Si](C)(C)C(C)(C)C)CC=C[C@@H]2N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C25H37NO3Si/c1-7-19-16-21-22(14-11-15-23(21)29-30(5,6)25(2,3)4)26(17-19)24(27)28-18-20-12-9-8-10-13-20/h7-14,19,21-23H,1,15-18H2,2-6H3/t19-,21+,22+,23-/m1/s1 |
| InChIKey | PGMCSRDHKFIUAU-YPIGPJMWSA-N |
| XLogP | 6.17 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.66 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|