C24H37NO6Si — CID 155793123
1-O-benzyl 2-O-methyl (2S,3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-3-prop-2-enylpyrrolidine-1,2-dicarboxylate (PubChem CID 155793123) has the molecular formula C24H37NO6Si and a molecular weight of 463.65 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2S,3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-3-prop-2-enylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2S,3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-3-prop-2-enylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 155793123 |
| Molecular Formula | C24H37NO6Si |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2S,3S,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-3-prop-2-enylpyrrolidine-1,2-dicarboxylate |
| SMILES | C=CC[C@]1(CO[Si](C)(C)C(C)(C)C)[C@@H](O)CN(C(=O)OCc2ccccc2)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C24H37NO6Si/c1-8-14-24(17-31-32(6,7)23(2,3)4)19(26)15-25(20(24)21(27)29-5)22(28)30-16-18-12-10-9-11-13-18/h8-13,19-20,26H,1,14-17H2,2-7H3/t19-,20+,24-/m0/s1 |
| InChIKey | VEMNPXXIZMCCOF-ROKPMTFOSA-N |
| XLogP | 4.13 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|