C26H39NO4Si — CID 46894260
benzyl (2R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(1-hydroxyprop-2-enyl)-6-prop-2-enyl-2,3-dihydropyridine-1-carboxylate (PubChem CID 46894260) has the molecular formula C26H39NO4Si and a molecular weight of 457.69 g/mol. Its IUPAC name is benzyl (2R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(1-hydroxyprop-2-enyl)-6-prop-2-enyl-2,3-dihydropyridine-1-carboxylate.
| Compound Name | benzyl (2R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(1-hydroxyprop-2-enyl)-6-prop-2-enyl-2,3-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 46894260 |
| Molecular Formula | C26H39NO4Si |
| Molecular Weight | 457.69 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | benzyl (2R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(1-hydroxyprop-2-enyl)-6-prop-2-enyl-2,3-dihydropyridine-1-carboxylate |
| SMILES | C=CC[C@@]1(C(O)C=C)C=CC[C@H](CO[Si](C)(C)C(C)(C)C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H39NO4Si/c1-8-17-26(23(28)9-2)18-13-16-22(20-31-32(6,7)25(3,4)5)27(26)24(29)30-19-21-14-11-10-12-15-21/h8-15,18,22-23,28H,1-2,16-17,19-20H2,3-7H3/t22-,23?,26+/m1/s1 |
| InChIKey | ATVJGUUAORGKJX-SATOSQONSA-N |
| XLogP | 5.84 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.69 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|