C31H45NO5Si — CID 177236675
dibenzyl 5-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]piperidine-1,3-dicarboxylate (PubChem CID 177236675) has the molecular formula C31H45NO5Si and a molecular weight of 539.79 g/mol. Its IUPAC name is dibenzyl 5-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]piperidine-1,3-dicarboxylate.
| Compound Name | dibenzyl 5-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 177236675 |
| Molecular Formula | C31H45NO5Si |
| Molecular Weight | 539.79 g/mol |
| Exact Mass | 539.31 |
| IUPAC Name | dibenzyl 5-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]piperidine-1,3-dicarboxylate |
| SMILES | CC(C)(CO[Si](C)(C)C(C)(C)C)C1CC(C(=O)OCc2ccccc2)CN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C31H45NO5Si/c1-30(2,3)38(6,7)37-23-31(4,5)27-18-26(28(33)35-21-24-14-10-8-11-15-24)19-32(20-27)29(34)36-22-25-16-12-9-13-17-25/h8-17,26-27H,18-23H2,1-7H3 |
| InChIKey | QCNFXTWZXGRHPU-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.79 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|