C25H35NO4Si — CID 11846416
benzyl (3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-hydroxy-7-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 11846416) has the molecular formula C25H35NO4Si and a molecular weight of 441.64 g/mol. Its IUPAC name is benzyl (3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-hydroxy-7-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | benzyl (3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-hydroxy-7-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 11846416 |
| Molecular Formula | C25H35NO4Si |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | benzyl (3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-hydroxy-7-methyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | Cc1ccc2c(c1O)CN(C(=O)OCc1ccccc1)[C@@H](CO[Si](C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C25H35NO4Si/c1-18-12-13-20-14-21(17-30-31(5,6)25(2,3)4)26(15-22(20)23(18)27)24(28)29-16-19-10-8-7-9-11-19/h7-13,21,27H,14-17H2,1-6H3/t21-/m1/s1 |
| InChIKey | ZYRZBMLTLWDPRN-OAQYLSRUSA-N |
| XLogP | 5.79 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|