C30H42N2O5Si — CID 155622770
benzyl (3R,4S,7R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-3-(phenylmethoxycarbonylamino)-2,3,4,7-tetrahydroazepine-1-carboxylate (PubChem CID 155622770) has the molecular formula C30H42N2O5Si and a molecular weight of 538.76 g/mol. Its IUPAC name is benzyl (3R,4S,7R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-3-(phenylmethoxycarbonylamino)-2,3,4,7-tetrahydroazepine-1-carboxylate.
| Compound Name | benzyl (3R,4S,7R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-3-(phenylmethoxycarbonylamino)-2,3,4,7-tetrahydroazepine-1-carboxylate |
|---|---|
| PubChem CID | 155622770 |
| Molecular Formula | C30H42N2O5Si |
| Molecular Weight | 538.76 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | benzyl (3R,4S,7R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methyl-3-(phenylmethoxycarbonylamino)-2,3,4,7-tetrahydroazepine-1-carboxylate |
| SMILES | C[C@H]1C=C[C@H](CO[Si](C)(C)C(C)(C)C)N(C(=O)OCc2ccccc2)C[C@@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H42N2O5Si/c1-23-17-18-26(22-37-38(5,6)30(2,3)4)32(29(34)36-21-25-15-11-8-12-16-25)19-27(23)31-28(33)35-20-24-13-9-7-10-14-24/h7-18,23,26-27H,19-22H2,1-6H3,(H,31,33)/t23-,26+,27-/m0/s1 |
| InChIKey | BPXJFNLXRJDTQO-RNJDCESWSA-N |
| XLogP | 6.52 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.76 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|