C21H31NO5Si — CID 101133628
benzyl N-[(1S,4R,5S,7S)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dioxabicyclo[3.2.1]oct-2-en-4-yl]carbamate (PubChem CID 101133628) has the molecular formula C21H31NO5Si and a molecular weight of 405.57 g/mol. Its IUPAC name is benzyl N-[(1S,4R,5S,7S)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dioxabicyclo[3.2.1]oct-2-en-4-yl]carbamate.
| Compound Name | benzyl N-[(1S,4R,5S,7S)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dioxabicyclo[3.2.1]oct-2-en-4-yl]carbamate |
|---|---|
| PubChem CID | 101133628 |
| Molecular Formula | C21H31NO5Si |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | benzyl N-[(1S,4R,5S,7S)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dioxabicyclo[3.2.1]oct-2-en-4-yl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H]2O[C@H]1C=C[C@H]2NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H31NO5Si/c1-21(2,3)28(4,5)25-14-18-17-12-11-16(19(26-17)27-18)22-20(23)24-13-15-9-7-6-8-10-15/h6-12,16-19H,13-14H2,1-5H3,(H,22,23)/t16-,17+,18+,19+/m1/s1 |
| InChIKey | YTIXABUXKBJGOL-XWSJACJDSA-N |
| XLogP | 3.98 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|