C26H39NO5Si — CID 11363482
benzyl N-[(1S,4R,5S,7S)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dioxabicyclo[3.2.1]oct-2-en-4-yl]-N-(3-methylbut-2-enyl)carbamate (PubChem CID 11363482) has the molecular formula C26H39NO5Si and a molecular weight of 473.69 g/mol. Its IUPAC name is benzyl N-[(1S,4R,5S,7S)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dioxabicyclo[3.2.1]oct-2-en-4-yl]-N-(3-methylbut-2-enyl)carbamate.
| Compound Name | benzyl N-[(1S,4R,5S,7S)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dioxabicyclo[3.2.1]oct-2-en-4-yl]-N-(3-methylbut-2-enyl)carbamate |
|---|---|
| PubChem CID | 11363482 |
| Molecular Formula | C26H39NO5Si |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | benzyl N-[(1S,4R,5S,7S)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dioxabicyclo[3.2.1]oct-2-en-4-yl]-N-(3-methylbut-2-enyl)carbamate |
| SMILES | CC(C)=CCN(C(=O)OCc1ccccc1)[C@@H]1C=C[C@@H]2O[C@H]1O[C@H]2CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H39NO5Si/c1-19(2)15-16-27(25(28)29-17-20-11-9-8-10-12-20)21-13-14-22-23(32-24(21)31-22)18-30-33(6,7)26(3,4)5/h8-15,21-24H,16-18H2,1-7H3/t21-,22+,23+,24+/m1/s1 |
| InChIKey | YIJQITVAXOAFBF-SBFWRKJZSA-N |
| XLogP | 5.66 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|