C25H37NO4Si — CID 101182456
N-[(1S,4R,5S,7S)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dioxabicyclo[3.2.1]oct-2-en-4-yl]-N-(3-methylbut-2-enyl)benzamide (PubChem CID 101182456) has the molecular formula C25H37NO4Si and a molecular weight of 443.66 g/mol. Its IUPAC name is N-[(1S,4R,5S,7S)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dioxabicyclo[3.2.1]oct-2-en-4-yl]-N-(3-methylbut-2-enyl)benzamide.
| Compound Name | N-[(1S,4R,5S,7S)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dioxabicyclo[3.2.1]oct-2-en-4-yl]-N-(3-methylbut-2-enyl)benzamide |
|---|---|
| PubChem CID | 101182456 |
| Molecular Formula | C25H37NO4Si |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | N-[(1S,4R,5S,7S)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,8-dioxabicyclo[3.2.1]oct-2-en-4-yl]-N-(3-methylbut-2-enyl)benzamide |
| SMILES | CC(C)=CCN(C(=O)c1ccccc1)[C@@H]1C=C[C@@H]2O[C@H]1O[C@H]2CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H37NO4Si/c1-18(2)15-16-26(23(27)19-11-9-8-10-12-19)20-13-14-21-22(30-24(20)29-21)17-28-31(6,7)25(3,4)5/h8-15,20-22,24H,16-17H2,1-7H3/t20-,21+,22+,24+/m1/s1 |
| InChIKey | BFUYPIKGPRTCDS-VCHRRKICSA-N |
| XLogP | 5.17 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|