C24H46O7Si2 — CID 11755802
[(2R,3S,6R,7S)-6-acetyloxy-2,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6,7-tetrahydrooxepin-3-yl] acetate (PubChem CID 11755802) has the molecular formula C24H46O7Si2 and a molecular weight of 502.80 g/mol. Its IUPAC name is [(2R,3S,6R,7S)-6-acetyloxy-2,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6,7-tetrahydrooxepin-3-yl] acetate.
| Compound Name | [(2R,3S,6R,7S)-6-acetyloxy-2,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6,7-tetrahydrooxepin-3-yl] acetate |
|---|---|
| PubChem CID | 11755802 |
| Molecular Formula | C24H46O7Si2 |
| Molecular Weight | 502.80 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | [(2R,3S,6R,7S)-6-acetyloxy-2,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3,6,7-tetrahydrooxepin-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@@H](OC(C)=O)[C@H](CO[Si](C)(C)C(C)(C)C)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H46O7Si2/c1-17(25)29-19-13-14-20(30-18(2)26)22(16-28-33(11,12)24(6,7)8)31-21(19)15-27-32(9,10)23(3,4)5/h13-14,19-22H,15-16H2,1-12H3/t19-,20+,21+,22- |
| InChIKey | ZAUIPDMZODPYRP-ZDNVTZCJSA-N |
| XLogP | 5.22 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.80 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|