C23H34O7Si — CID 86697578
[(2R,3S,6S)-3-acetyloxy-6-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 86697578) has the molecular formula C23H34O7Si and a molecular weight of 450.60 g/mol. Its IUPAC name is [(2R,3S,6S)-3-acetyloxy-6-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6S)-3-acetyloxy-6-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 86697578 |
| Molecular Formula | C23H34O7Si |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | [(2R,3S,6S)-3-acetyloxy-6-[3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyphenyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | COc1ccc([C@@H]2C=C[C@H](OC(C)=O)[C@@H](COC(C)=O)O2)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H34O7Si/c1-15(24)27-14-22-20(28-16(2)25)12-11-18(29-22)17-9-10-19(26-6)21(13-17)30-31(7,8)23(3,4)5/h9-13,18,20,22H,14H2,1-8H3/t18-,20-,22+/m0/s1 |
| InChIKey | CSMATLYXIUXVKO-RCZSKKKRSA-N |
| XLogP | 4.57 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|