C17H17F3O5 — CID 11279791
[(2R,3S,6S)-3-acetyloxy-6-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 11279791) has the molecular formula C17H17F3O5 and a molecular weight of 358.31 g/mol. Its IUPAC name is [(2R,3S,6S)-3-acetyloxy-6-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6S)-3-acetyloxy-6-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11279791 |
| Molecular Formula | C17H17F3O5 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | [(2R,3S,6S)-3-acetyloxy-6-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](c2ccc(C(F)(F)F)cc2)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H17F3O5/c1-10(21)23-9-16-15(24-11(2)22)8-7-14(25-16)12-3-5-13(6-4-12)17(18,19)20/h3-8,14-16H,9H2,1-2H3/t14-,15-,16+/m0/s1 |
| InChIKey | UBEAKPDVOVYRDN-HRCADAONSA-N |
| XLogP | 3.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|