C17H17F3O4 — CID 134928557
[(2S,3S,6S)-3-acetyl-6-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 134928557) has the molecular formula C17H17F3O4 and a molecular weight of 342.31 g/mol. Its IUPAC name is [(2S,3S,6S)-3-acetyl-6-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2S,3S,6S)-3-acetyl-6-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134928557 |
| Molecular Formula | C17H17F3O4 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | [(2S,3S,6S)-3-acetyl-6-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](c2ccc(C(F)(F)F)cc2)C=C[C@@H]1C(C)=O |
| InChI | InChI=1S/C17H17F3O4/c1-10(21)14-7-8-15(24-16(14)9-23-11(2)22)12-3-5-13(6-4-12)17(18,19)20/h3-8,14-16H,9H2,1-2H3/t14-,15+,16-/m1/s1 |
| InChIKey | CDNRZHLMMWUJRQ-OWCLPIDISA-N |
| XLogP | 3.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|