C26H30O10 — CID 123617972
[3-acetyloxy-6-[4-[3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]phenyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 123617972) has the molecular formula C26H30O10 and a molecular weight of 502.52 g/mol. Its IUPAC name is [3-acetyloxy-6-[4-[3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]phenyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [3-acetyloxy-6-[4-[3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]phenyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 123617972 |
| Molecular Formula | C26H30O10 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | [3-acetyloxy-6-[4-[3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]phenyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(c2ccc(C3C=CC(OC(C)=O)C(COC(C)=O)O3)cc2)C=CC1OC(C)=O |
| InChI | InChI=1S/C26H30O10/c1-15(27)31-13-25-23(33-17(3)29)11-9-21(35-25)19-5-7-20(8-6-19)22-10-12-24(34-18(4)30)26(36-22)14-32-16(2)28/h5-12,21-26H,13-14H2,1-4H3 |
| InChIKey | QSLSVRAAWNFYKR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|