C23H26O9 — CID 101367443
dimethyl 5-[(2R,3S,6S)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]-1,3-dihydroindene-2,2-dicarboxylate (PubChem CID 101367443) has the molecular formula C23H26O9 and a molecular weight of 446.45 g/mol. Its IUPAC name is dimethyl 5-[(2R,3S,6S)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]-1,3-dihydroindene-2,2-dicarboxylate.
| Compound Name | dimethyl 5-[(2R,3S,6S)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]-1,3-dihydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 101367443 |
| Molecular Formula | C23H26O9 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | dimethyl 5-[(2R,3S,6S)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]-1,3-dihydroindene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2ccc([C@@H]3C=C[C@H](OC(C)=O)[C@@H](COC(C)=O)O3)cc2C1 |
| InChI | InChI=1S/C23H26O9/c1-13(24)30-12-20-19(31-14(2)25)8-7-18(32-20)15-5-6-16-10-23(21(26)28-3,22(27)29-4)11-17(16)9-15/h5-9,18-20H,10-12H2,1-4H3/t18-,19-,20+/m0/s1 |
| InChIKey | ZKOSOZXLLGWECF-SLFFLAALSA-N |
| XLogP | 1.61 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|