C33H38O14 — CID 101367448
dimethyl 4,6-bis[(2R,3S,6S)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]-1,3-dihydroindene-2,2-dicarboxylate (PubChem CID 101367448) has the molecular formula C33H38O14 and a molecular weight of 658.65 g/mol. Its IUPAC name is dimethyl 4,6-bis[(2R,3S,6S)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]-1,3-dihydroindene-2,2-dicarboxylate.
| Compound Name | dimethyl 4,6-bis[(2R,3S,6S)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]-1,3-dihydroindene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 101367448 |
| Molecular Formula | C33H38O14 |
| Molecular Weight | 658.65 g/mol |
| Exact Mass | 658.23 |
| IUPAC Name | dimethyl 4,6-bis[(2R,3S,6S)-3-acetyloxy-2-(acetyloxymethyl)-3,6-dihydro-2H-pyran-6-yl]-1,3-dihydroindene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2cc([C@@H]3C=C[C@H](OC(C)=O)[C@@H](COC(C)=O)O3)cc([C@@H]3C=C[C@H](OC(C)=O)[C@@H](COC(C)=O)O3)c2C1 |
| InChI | InChI=1S/C33H38O14/c1-17(34)42-15-29-27(44-19(3)36)9-7-25(46-29)21-11-22-13-33(31(38)40-5,32(39)41-6)14-24(22)23(12-21)26-8-10-28(45-20(4)37)30(47-26)16-43-18(2)35/h7-12,25-30H,13-16H2,1-6H3/t25-,26-,27-,28-,29+,30+/m0/s1 |
| InChIKey | FDZUBYYLROLGKX-XZSFGIKTSA-N |
| XLogP | 2.10 |
| TPSA | 176.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.65 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|