C16H18O5 — CID 172704667
[(2R,3S,6S)-3-ethenoxy-6-(4-hydroxyphenyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 172704667) has the molecular formula C16H18O5 and a molecular weight of 290.32 g/mol. Its IUPAC name is [(2R,3S,6S)-3-ethenoxy-6-(4-hydroxyphenyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6S)-3-ethenoxy-6-(4-hydroxyphenyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 172704667 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | [(2R,3S,6S)-3-ethenoxy-6-(4-hydroxyphenyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | C=CO[C@H]1C=C[C@@H](c2ccc(O)cc2)O[C@@H]1COC(C)=O |
| InChI | InChI=1S/C16H18O5/c1-3-19-15-9-8-14(12-4-6-13(18)7-5-12)21-16(15)10-20-11(2)17/h3-9,14-16,18H,1,10H2,2H3/t14-,15-,16+/m0/s1 |
| InChIKey | DKRPLXBHCGWXKT-HRCADAONSA-N |
| XLogP | 2.48 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|