C10H14O6 — CID 70846153
[(3S)-3-acetyloxy-6-hydroxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 70846153) has the molecular formula C10H14O6 and a molecular weight of 230.22 g/mol. Its IUPAC name is [(3S)-3-acetyloxy-6-hydroxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(3S)-3-acetyloxy-6-hydroxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70846153 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | [(3S)-3-acetyloxy-6-hydroxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(O)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C10H14O6/c1-6(11)14-5-9-8(15-7(2)12)3-4-10(13)16-9/h3-4,8-10,13H,5H2,1-2H3/t8-,9?,10?/m0/s1 |
| InChIKey | IXURAOVGILUYRP-IDKOKCKLSA-N |
| XLogP | -0.25 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|