C12H13IO5 — CID 134864349
[(2R,3R,6S)-3-acetyloxy-6-(2-iodoethynyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 134864349) has the molecular formula C12H13IO5 and a molecular weight of 364.14 g/mol. Its IUPAC name is [(2R,3R,6S)-3-acetyloxy-6-(2-iodoethynyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3R,6S)-3-acetyloxy-6-(2-iodoethynyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134864349 |
| Molecular Formula | C12H13IO5 |
| Molecular Weight | 364.14 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | [(2R,3R,6S)-3-acetyloxy-6-(2-iodoethynyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](C#CI)C=C[C@H]1OC(C)=O |
| InChI | InChI=1S/C12H13IO5/c1-8(14)16-7-12-11(17-9(2)15)4-3-10(18-12)5-6-13/h3-4,10-12H,7H2,1-2H3/t10-,11+,12+/m0/s1 |
| InChIKey | KEHPGGIXIOOAAC-QJPTWQEYSA-N |
| XLogP | 1.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.14 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|