C18H17ClO5 — CID 73441036
[(2R,3S,6S)-3-acetyloxy-6-[2-(3-chlorophenyl)ethynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 73441036) has the molecular formula C18H17ClO5 and a molecular weight of 348.78 g/mol. Its IUPAC name is [(2R,3S,6S)-3-acetyloxy-6-[2-(3-chlorophenyl)ethynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6S)-3-acetyloxy-6-[2-(3-chlorophenyl)ethynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 73441036 |
| Molecular Formula | C18H17ClO5 |
| Molecular Weight | 348.78 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | [(2R,3S,6S)-3-acetyloxy-6-[2-(3-chlorophenyl)ethynyl]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](C#Cc2cccc(Cl)c2)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H17ClO5/c1-12(20)22-11-18-17(23-13(2)21)9-8-16(24-18)7-6-14-4-3-5-15(19)10-14/h3-5,8-10,16-18H,11H2,1-2H3/t16-,17+,18-/m1/s1 |
| InChIKey | FTNKOBVSNCLAQN-FGTMMUONSA-N |
| XLogP | 2.51 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.78 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|