C21H36O4Si — CID 58292429
(3R,4S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,6-dimethyl-5-phenylmethoxyoxan-3-ol (PubChem CID 58292429) has the molecular formula C21H36O4Si and a molecular weight of 380.60 g/mol. Its IUPAC name is (3R,4S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,6-dimethyl-5-phenylmethoxyoxan-3-ol.
| Compound Name | (3R,4S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,6-dimethyl-5-phenylmethoxyoxan-3-ol |
|---|---|
| PubChem CID | 58292429 |
| Molecular Formula | C21H36O4Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | (3R,4S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,6-dimethyl-5-phenylmethoxyoxan-3-ol |
| SMILES | C[C@@H]1OC(CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](C)C1OCc1ccccc1 |
| InChI | InChI=1S/C21H36O4Si/c1-15-19(22)18(14-24-26(6,7)21(3,4)5)25-16(2)20(15)23-13-17-11-9-8-10-12-17/h8-12,15-16,18-20,22H,13-14H2,1-7H3/t15-,16-,18?,19+,20?/m0/s1 |
| InChIKey | TUZKKRXVMHOCMG-YGOYDHPHSA-N |
| XLogP | 4.38 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|