C21H34O4Si — CID 58292531
(4R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,6-dimethyl-5-phenylmethoxyoxan-3-one (PubChem CID 58292531) has the molecular formula C21H34O4Si and a molecular weight of 378.59 g/mol. Its IUPAC name is (4R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,6-dimethyl-5-phenylmethoxyoxan-3-one.
| Compound Name | (4R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,6-dimethyl-5-phenylmethoxyoxan-3-one |
|---|---|
| PubChem CID | 58292531 |
| Molecular Formula | C21H34O4Si |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | (4R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,6-dimethyl-5-phenylmethoxyoxan-3-one |
| SMILES | C[C@@H]1OC(CO[Si](C)(C)C(C)(C)C)C(=O)[C@H](C)C1OCc1ccccc1 |
| InChI | InChI=1S/C21H34O4Si/c1-15-19(22)18(14-24-26(6,7)21(3,4)5)25-16(2)20(15)23-13-17-11-9-8-10-12-17/h8-12,15-16,18,20H,13-14H2,1-7H3/t15-,16-,18?,20?/m0/s1 |
| InChIKey | DEEYTLIKABRGDQ-MQFISKJYSA-N |
| XLogP | 4.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|