C15H24O5SSi — CID 102524605
tert-butyl-[[(4S,5S)-2,2-dioxo-5-phenyl-1,3,2-dioxathiolan-4-yl]methoxy]-dimethylsilane (PubChem CID 102524605) has the molecular formula C15H24O5SSi and a molecular weight of 344.50 g/mol. Its IUPAC name is tert-butyl-[[(4S,5S)-2,2-dioxo-5-phenyl-1,3,2-dioxathiolan-4-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(4S,5S)-2,2-dioxo-5-phenyl-1,3,2-dioxathiolan-4-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 102524605 |
| Molecular Formula | C15H24O5SSi |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | tert-butyl-[[(4S,5S)-2,2-dioxo-5-phenyl-1,3,2-dioxathiolan-4-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1OS(=O)(=O)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H24O5SSi/c1-15(2,3)22(4,5)18-11-13-14(20-21(16,17)19-13)12-9-7-6-8-10-12/h6-10,13-14H,11H2,1-5H3/t13-,14-/m0/s1 |
| InChIKey | QDTUUICXAZJQKH-KBPBESRZSA-N |
| XLogP | 3.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|