C22H35NO3Si — CID 11014618
(2S,3S,8aR)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-8a-ethyl-2-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one (PubChem CID 11014618) has the molecular formula C22H35NO3Si and a molecular weight of 389.61 g/mol. Its IUPAC name is (2S,3S,8aR)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-8a-ethyl-2-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one.
| Compound Name | (2S,3S,8aR)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-8a-ethyl-2-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 11014618 |
| Molecular Formula | C22H35NO3Si |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | (2S,3S,8aR)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-8a-ethyl-2-phenyl-3,6,7,8-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-5-one |
| SMILES | CC[C@@]12CCCC(=O)N1[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](c1ccccc1)O2 |
| InChI | InChI=1S/C22H35NO3Si/c1-7-22-15-11-14-19(24)23(22)18(16-25-27(5,6)21(2,3)4)20(26-22)17-12-9-8-10-13-17/h8-10,12-13,18,20H,7,11,14-16H2,1-6H3/t18-,20-,22+/m0/s1 |
| InChIKey | UEVFLJHHWPMICJ-RCZSKKKRSA-N |
| XLogP | 5.27 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|