C23H31NO3Si — CID 15408396
(4S,5S)-3-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 15408396) has the molecular formula C23H31NO3Si and a molecular weight of 397.59 g/mol. Its IUPAC name is (4S,5S)-3-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5S)-3-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 15408396 |
| Molecular Formula | C23H31NO3Si |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | (4S,5S)-3-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OC(=O)N(Cc2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H31NO3Si/c1-23(2,3)28(4,5)26-17-20-21(19-14-10-7-11-15-19)24(22(25)27-20)16-18-12-8-6-9-13-18/h6-15,20-21H,16-17H2,1-5H3/t20-,21+/m1/s1 |
| InChIKey | GAMRSKKXZPMPMZ-RTWAWAEBSA-N |
| XLogP | 5.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|