C23H36N2O4Si — CID 101423722
(2R,3S,6R,7S)-4-benzyl-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-hydroxy-2-propan-2-yl-1,4-diazabicyclo[4.2.0]octane-5,8-dione (PubChem CID 101423722) has the molecular formula C23H36N2O4Si and a molecular weight of 432.64 g/mol. Its IUPAC name is (2R,3S,6R,7S)-4-benzyl-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-hydroxy-2-propan-2-yl-1,4-diazabicyclo[4.2.0]octane-5,8-dione.
| Compound Name | (2R,3S,6R,7S)-4-benzyl-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-hydroxy-2-propan-2-yl-1,4-diazabicyclo[4.2.0]octane-5,8-dione |
|---|---|
| PubChem CID | 101423722 |
| Molecular Formula | C23H36N2O4Si |
| Molecular Weight | 432.64 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | (2R,3S,6R,7S)-4-benzyl-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-hydroxy-2-propan-2-yl-1,4-diazabicyclo[4.2.0]octane-5,8-dione |
| SMILES | CC(C)[C@@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)N(Cc2ccccc2)C(=O)[C@H]2[C@H](O)C(=O)N12 |
| InChI | InChI=1S/C23H36N2O4Si/c1-15(2)18-17(14-29-30(6,7)23(3,4)5)24(13-16-11-9-8-10-12-16)21(27)19-20(26)22(28)25(18)19/h8-12,15,17-20,26H,13-14H2,1-7H3/t17-,18-,19-,20+/m1/s1 |
| InChIKey | HVPNBKLZUIMNKE-WTGUMLROSA-N |
| XLogP | 3.02 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.64 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|