C17H26F3NOSi — CID 23243951
[(2R,3R)-1-benzyl-3-(trifluoromethyl)aziridin-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 23243951) has the molecular formula C17H26F3NOSi and a molecular weight of 345.48 g/mol. Its IUPAC name is [(2R,3R)-1-benzyl-3-(trifluoromethyl)aziridin-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R)-1-benzyl-3-(trifluoromethyl)aziridin-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 23243951 |
| Molecular Formula | C17H26F3NOSi |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | [(2R,3R)-1-benzyl-3-(trifluoromethyl)aziridin-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1[C@H](C(F)(F)F)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H26F3NOSi/c1-16(2,3)23(4,5)22-12-14-15(17(18,19)20)21(14)11-13-9-7-6-8-10-13/h6-10,14-15H,11-12H2,1-5H3/t14-,15+,21?/m0/s1 |
| InChIKey | HQOVLMXATXNEBS-ZOMUKPOZSA-N |
| XLogP | 4.82 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|