C23H31NO3Si — CID 10992980
(3R,4R)-1-benzyl-4-[(R)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-3-hydroxyazetidin-2-one (PubChem CID 10992980) has the molecular formula C23H31NO3Si and a molecular weight of 397.59 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-4-[(R)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-3-hydroxyazetidin-2-one.
| Compound Name | (3R,4R)-1-benzyl-4-[(R)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-3-hydroxyazetidin-2-one |
|---|---|
| PubChem CID | 10992980 |
| Molecular Formula | C23H31NO3Si |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | (3R,4R)-1-benzyl-4-[(R)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-3-hydroxyazetidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](c1ccccc1)[C@H]1[C@@H](O)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H31NO3Si/c1-23(2,3)28(4,5)27-21(18-14-10-7-11-15-18)19-20(25)22(26)24(19)16-17-12-8-6-9-13-17/h6-15,19-21,25H,16H2,1-5H3/t19-,20-,21-/m1/s1 |
| InChIKey | YEZOVALUMDTXFQ-NJDAHSKKSA-N |
| XLogP | 4.52 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|