C22H34N2O5Si — CID 11517701
methyl 2-[[(2S)-2-[(2R,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethylidene]amino]acetate (PubChem CID 11517701) has the molecular formula C22H34N2O5Si and a molecular weight of 434.61 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-[(2R,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethylidene]amino]acetate.
| Compound Name | methyl 2-[[(2S)-2-[(2R,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethylidene]amino]acetate |
|---|---|
| PubChem CID | 11517701 |
| Molecular Formula | C22H34N2O5Si |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | methyl 2-[[(2S)-2-[(2R,3R)-1-benzyl-3-methoxy-4-oxoazetidin-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethylidene]amino]acetate |
| SMILES | COC(=O)C/N=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1[C@@H](OC)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H34N2O5Si/c1-22(2,3)30(6,7)29-17(13-23-14-18(25)27-4)19-20(28-5)21(26)24(19)15-16-11-9-8-10-12-16/h8-13,17,19-20H,14-15H2,1-7H3/b23-13+/t17-,19+,20-/m1/s1 |
| InChIKey | JKZPOBCCTARJRL-FDSQJSGGSA-N |
| XLogP | 3.05 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|