C12H13NO3 — CID 102475889
(2R,3R)-1-benzyl-3-methoxy-4-oxoazetidine-2-carbaldehyde (PubChem CID 102475889) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is (2R,3R)-1-benzyl-3-methoxy-4-oxoazetidine-2-carbaldehyde.
| Compound Name | (2R,3R)-1-benzyl-3-methoxy-4-oxoazetidine-2-carbaldehyde |
|---|---|
| PubChem CID | 102475889 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (2R,3R)-1-benzyl-3-methoxy-4-oxoazetidine-2-carbaldehyde |
| SMILES | CO[C@H]1C(=O)N(Cc2ccccc2)[C@H]1C=O |
| InChI | InChI=1S/C12H13NO3/c1-16-11-10(8-14)13(12(11)15)7-9-5-3-2-4-6-9/h2-6,8,10-11H,7H2,1H3/t10-,11+/m0/s1 |
| InChIKey | IEQBPWMQPPUHQD-WDEREUQCSA-N |
| XLogP | 0.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|