C15H19NO2 — CID 50937013
(1R,4S,5R)-2-benzyl-5-methoxy-2-azabicyclo[2.2.2]octan-3-one (PubChem CID 50937013) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (1R,4S,5R)-2-benzyl-5-methoxy-2-azabicyclo[2.2.2]octan-3-one.
| Compound Name | (1R,4S,5R)-2-benzyl-5-methoxy-2-azabicyclo[2.2.2]octan-3-one |
|---|---|
| PubChem CID | 50937013 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (1R,4S,5R)-2-benzyl-5-methoxy-2-azabicyclo[2.2.2]octan-3-one |
| SMILES | CO[C@@H]1C[C@H]2CC[C@@H]1C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C15H19NO2/c1-18-14-9-12-7-8-13(14)15(17)16(12)10-11-5-3-2-4-6-11/h2-6,12-14H,7-10H2,1H3/t12-,13+,14-/m1/s1 |
| InChIKey | ICVZVLHCEFXCIO-HZSPNIEDSA-N |
| XLogP | 2.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |